C22H19BrClF2NO2 — CID 66541120
N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-fluoroaniline (PubChem CID 66541120) has the molecular formula C22H19BrClF2NO2 and a molecular weight of 482.75 g/mol. Its IUPAC name is N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-fluoroaniline.
| Compound Name | N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 66541120 |
| Molecular Formula | C22H19BrClF2NO2 |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-4-fluoroaniline |
| SMILES | CCOc1cc(CNc2ccc(F)cc2)c(Br)cc1OCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C22H19BrClF2NO2/c1-2-28-21-9-15(12-27-18-7-5-16(25)6-8-18)19(23)11-22(21)29-13-14-3-4-17(26)10-20(14)24/h3-11,27H,2,12-13H2,1H3 |
| InChIKey | PIHJMLBIRJZRLK-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |