C23H20BrClFNO4 — CID 66541298
N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-1,3-benzodioxol-5-amine (PubChem CID 66541298) has the molecular formula C23H20BrClFNO4 and a molecular weight of 508.77 g/mol. Its IUPAC name is N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-1,3-benzodioxol-5-amine.
| Compound Name | N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 66541298 |
| Molecular Formula | C23H20BrClFNO4 |
| Molecular Weight | 508.77 g/mol |
| Exact Mass | 507.02 |
| IUPAC Name | N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-1,3-benzodioxol-5-amine |
| SMILES | CCOc1cc(CNc2ccc3c(c2)OCO3)c(Br)cc1OCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C23H20BrClFNO4/c1-2-28-21-7-15(11-27-17-5-6-20-22(9-17)31-13-30-20)18(24)10-23(21)29-12-14-3-4-16(26)8-19(14)25/h3-10,27H,2,11-13H2,1H3 |
| InChIKey | OCKBKEVDTZFZGV-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.77 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|