C20H25BrClFN2O2 — CID 66538326
N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 66538326) has the molecular formula C20H25BrClFN2O2 and a molecular weight of 459.79 g/mol. Its IUPAC name is N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 66538326 |
| Molecular Formula | C20H25BrClFN2O2 |
| Molecular Weight | 459.79 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | N-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CCOc1cc(CNCCN(C)C)c(Br)cc1OCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C20H25BrClFN2O2/c1-4-26-19-9-15(12-24-7-8-25(2)3)17(21)11-20(19)27-13-14-5-6-16(23)10-18(14)22/h5-6,9-11,24H,4,7-8,12-13H2,1-3H3 |
| InChIKey | HOWJNDBRHOONRX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.79 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|