C19H22BrClFNO4 — CID 66534836
2-[2-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-methoxyphenyl]methylamino]ethoxy]ethanol (PubChem CID 66534836) has the molecular formula C19H22BrClFNO4 and a molecular weight of 462.74 g/mol. Its IUPAC name is 2-[2-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-methoxyphenyl]methylamino]ethoxy]ethanol.
| Compound Name | 2-[2-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-methoxyphenyl]methylamino]ethoxy]ethanol |
|---|---|
| PubChem CID | 66534836 |
| Molecular Formula | C19H22BrClFNO4 |
| Molecular Weight | 462.74 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | 2-[2-[[2-bromo-4-[(2-chloro-4-fluorophenyl)methoxy]-5-methoxyphenyl]methylamino]ethoxy]ethanol |
| SMILES | COc1cc(CNCCOCCO)c(Br)cc1OCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C19H22BrClFNO4/c1-25-18-8-14(11-23-4-6-26-7-5-24)16(20)10-19(18)27-12-13-2-3-15(22)9-17(13)21/h2-3,8-10,23-24H,4-7,11-12H2,1H3 |
| InChIKey | FRSVENPXYYSDAT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.74 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|