C18H20Cl2FNO2 — CID 66530045
N-[[2-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]propan-1-amine (PubChem CID 66530045) has the molecular formula C18H20Cl2FNO2 and a molecular weight of 372.27 g/mol. Its IUPAC name is N-[[2-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]propan-1-amine.
| Compound Name | N-[[2-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66530045 |
| Molecular Formula | C18H20Cl2FNO2 |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-[[2-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(OC)c(OCc2ccc(F)cc2Cl)cc1Cl |
| InChI | InChI=1S/C18H20Cl2FNO2/c1-3-6-22-10-13-7-17(23-2)18(9-16(13)20)24-11-12-4-5-14(21)8-15(12)19/h4-5,7-9,22H,3,6,10-11H2,1-2H3 |
| InChIKey | XHASILBFDZERPZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|