C23H21Cl3FNO2 — CID 66529536
N-[[2-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(4-fluorophenyl)ethanamine (PubChem CID 66529536) has the molecular formula C23H21Cl3FNO2 and a molecular weight of 468.78 g/mol. Its IUPAC name is N-[[2-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(4-fluorophenyl)ethanamine.
| Compound Name | N-[[2-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(4-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 66529536 |
| Molecular Formula | C23H21Cl3FNO2 |
| Molecular Weight | 468.78 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | N-[[2-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(4-fluorophenyl)ethanamine |
| SMILES | COc1cc(CNCCc2ccc(F)cc2)c(Cl)cc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H21Cl3FNO2/c1-29-22-10-17(13-28-9-8-15-2-6-19(27)7-3-15)21(26)12-23(22)30-14-16-4-5-18(24)11-20(16)25/h2-7,10-12,28H,8-9,13-14H2,1H3 |
| InChIKey | NCZMYTNYBLFLAD-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.78 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|