C23H24Cl3NO2 — CID 17292530
N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride (PubChem CID 17292530) has the molecular formula C23H24Cl3NO2 and a molecular weight of 452.81 g/mol. Its IUPAC name is N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride.
| Compound Name | N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17292530 |
| Molecular Formula | C23H24Cl3NO2 |
| Molecular Weight | 452.81 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride |
| SMILES | COc1ccc(CCNCc2ccccc2OCc2ccc(Cl)cc2Cl)cc1.Cl |
| InChI | InChI=1S/C23H23Cl2NO2.ClH/c1-27-21-10-6-17(7-11-21)12-13-26-15-18-4-2-3-5-23(18)28-16-19-8-9-20(24)14-22(19)25;/h2-11,14,26H,12-13,15-16H2,1H3;1H |
| InChIKey | QIQNFOPCCCDPBZ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.81 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|