C24H25ClFNO3 — CID 4716351
N-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine (PubChem CID 4716351) has the molecular formula C24H25ClFNO3 and a molecular weight of 429.92 g/mol. Its IUPAC name is N-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine.
| Compound Name | N-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 4716351 |
| Molecular Formula | C24H25ClFNO3 |
| Molecular Weight | 429.92 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine |
| SMILES | COc1ccc(CCNCc2cc(Cl)ccc2OCc2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C24H25ClFNO3/c1-28-23-9-5-17(13-24(23)29-2)11-12-27-15-19-14-20(25)6-10-22(19)30-16-18-3-7-21(26)8-4-18/h3-10,13-14,27H,11-12,15-16H2,1-2H3 |
| InChIKey | FXSVCIURAFBTTE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.92 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|