C25H27BrClNO4 — CID 66534349
N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine (PubChem CID 66534349) has the molecular formula C25H27BrClNO4 and a molecular weight of 520.85 g/mol. Its IUPAC name is N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine.
| Compound Name | N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 66534349 |
| Molecular Formula | C25H27BrClNO4 |
| Molecular Weight | 520.85 g/mol |
| Exact Mass | 519.08 |
| IUPAC Name | N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine |
| SMILES | COc1ccc(CCNCc2cc(OC)c(OCc3ccc(Cl)cc3)cc2Br)cc1OC |
| InChI | InChI=1S/C25H27BrClNO4/c1-29-22-9-6-17(12-23(22)30-2)10-11-28-15-19-13-24(31-3)25(14-21(19)26)32-16-18-4-7-20(27)8-5-18/h4-9,12-14,28H,10-11,15-16H2,1-3H3 |
| InChIKey | KGRVXTHOCRSBLG-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.85 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|