C25H26BrCl2NO4 — CID 66534839
N-[[2-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine (PubChem CID 66534839) has the molecular formula C25H26BrCl2NO4 and a molecular weight of 555.30 g/mol. Its IUPAC name is N-[[2-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine.
| Compound Name | N-[[2-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 66534839 |
| Molecular Formula | C25H26BrCl2NO4 |
| Molecular Weight | 555.30 g/mol |
| Exact Mass | 553.04 |
| IUPAC Name | N-[[2-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(3,4-dimethoxyphenyl)ethanamine |
| SMILES | COc1ccc(CCNCc2cc(OC)c(OCc3c(Cl)cccc3Cl)cc2Br)cc1OC |
| InChI | InChI=1S/C25H26BrCl2NO4/c1-30-22-8-7-16(11-23(22)31-2)9-10-29-14-17-12-24(32-3)25(13-19(17)26)33-15-18-20(27)5-4-6-21(18)28/h4-8,11-13,29H,9-10,14-15H2,1-3H3 |
| InChIKey | AZSSEWUAEUMFJA-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.30 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|