C17H20Cl3NO2 — CID 17290505
N-[(2,6-dichlorophenyl)methyl]-2-(3,4-dimethoxyphenyl)ethanamine;hydrochloride (PubChem CID 17290505) has the molecular formula C17H20Cl3NO2 and a molecular weight of 376.71 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methyl]-2-(3,4-dimethoxyphenyl)ethanamine;hydrochloride.
| Compound Name | N-[(2,6-dichlorophenyl)methyl]-2-(3,4-dimethoxyphenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17290505 |
| Molecular Formula | C17H20Cl3NO2 |
| Molecular Weight | 376.71 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methyl]-2-(3,4-dimethoxyphenyl)ethanamine;hydrochloride |
| SMILES | COc1ccc(CCNCc2c(Cl)cccc2Cl)cc1OC.Cl |
| InChI | InChI=1S/C17H19Cl2NO2.ClH/c1-21-16-7-6-12(10-17(16)22-2)8-9-20-11-13-14(18)4-3-5-15(13)19;/h3-7,10,20H,8-9,11H2,1-2H3;1H |
| InChIKey | IRIXEKSVVCVHKG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.71 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|