C19H22ClNO6 — CID 17367589
2-(3-chlorophenyl)-N-[(3,4-dimethoxyphenyl)methyl]ethanamine;oxalic acid (PubChem CID 17367589) has the molecular formula C19H22ClNO6 and a molecular weight of 395.84 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-[(3,4-dimethoxyphenyl)methyl]ethanamine;oxalic acid.
| Compound Name | 2-(3-chlorophenyl)-N-[(3,4-dimethoxyphenyl)methyl]ethanamine;oxalic acid |
|---|---|
| PubChem CID | 17367589 |
| Molecular Formula | C19H22ClNO6 |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-(3-chlorophenyl)-N-[(3,4-dimethoxyphenyl)methyl]ethanamine;oxalic acid |
| SMILES | COc1ccc(CNCCc2cccc(Cl)c2)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H20ClNO2.C2H2O4/c1-20-16-7-6-14(11-17(16)21-2)12-19-9-8-13-4-3-5-15(18)10-13;3-1(4)2(5)6/h3-7,10-11,19H,8-9,12H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | ZFVFVBVOALLSRH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|