C17H18ClNO4 — CID 66527554
2-[[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methylamino]acetic acid (PubChem CID 66527554) has the molecular formula C17H18ClNO4 and a molecular weight of 335.79 g/mol. Its IUPAC name is 2-[[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methylamino]acetic acid.
| Compound Name | 2-[[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methylamino]acetic acid |
|---|---|
| PubChem CID | 66527554 |
| Molecular Formula | C17H18ClNO4 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-[[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methylamino]acetic acid |
| SMILES | COc1cc(CNCC(=O)O)ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H18ClNO4/c1-22-16-8-12(9-19-10-17(20)21)5-6-15(16)23-11-13-3-2-4-14(18)7-13/h2-8,19H,9-11H2,1H3,(H,20,21) |
| InChIKey | ULXKCXFYUMBDPH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |