C18H21Cl2NO2 — CID 17294378
N-[[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]cyclopropanamine;hydrochloride (PubChem CID 17294378) has the molecular formula C18H21Cl2NO2 and a molecular weight of 354.28 g/mol. Its IUPAC name is N-[[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]cyclopropanamine;hydrochloride.
| Compound Name | N-[[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]cyclopropanamine;hydrochloride |
|---|---|
| PubChem CID | 17294378 |
| Molecular Formula | C18H21Cl2NO2 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | N-[[4-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]cyclopropanamine;hydrochloride |
| SMILES | COc1cc(CNC2CC2)ccc1OCc1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C18H20ClNO2.ClH/c1-21-18-10-13(11-20-16-6-7-16)5-8-17(18)22-12-14-3-2-4-15(19)9-14;/h2-5,8-10,16,20H,6-7,11-12H2,1H3;1H |
| InChIKey | KGHCOTPIPQLLPR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |