C17H18ClNO — CID 39390007
N-[[4-[(3-chlorophenyl)methoxy]phenyl]methyl]cyclopropanamine (PubChem CID 39390007) has the molecular formula C17H18ClNO and a molecular weight of 287.79 g/mol. Its IUPAC name is N-[[4-[(3-chlorophenyl)methoxy]phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[4-[(3-chlorophenyl)methoxy]phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 39390007 |
| Molecular Formula | C17H18ClNO |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N-[[4-[(3-chlorophenyl)methoxy]phenyl]methyl]cyclopropanamine |
| SMILES | Clc1cccc(COc2ccc(CNC3CC3)cc2)c1 |
| InChI | InChI=1S/C17H18ClNO/c18-15-3-1-2-14(10-15)12-20-17-8-4-13(5-9-17)11-19-16-6-7-16/h1-5,8-10,16,19H,6-7,11-12H2 |
| InChIKey | ZVESUSCPILJHDF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |