C17H17Cl2NO — CID 107305713
N-[[4-[(2,3-dichlorophenyl)methoxy]phenyl]methyl]cyclopropanamine (PubChem CID 107305713) has the molecular formula C17H17Cl2NO and a molecular weight of 322.24 g/mol. Its IUPAC name is N-[[4-[(2,3-dichlorophenyl)methoxy]phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[4-[(2,3-dichlorophenyl)methoxy]phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 107305713 |
| Molecular Formula | C17H17Cl2NO |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N-[[4-[(2,3-dichlorophenyl)methoxy]phenyl]methyl]cyclopropanamine |
| SMILES | Clc1cccc(COc2ccc(CNC3CC3)cc2)c1Cl |
| InChI | InChI=1S/C17H17Cl2NO/c18-16-3-1-2-13(17(16)19)11-21-15-8-4-12(5-9-15)10-20-14-6-7-14/h1-5,8-9,14,20H,6-7,10-11H2 |
| InChIKey | YOMLLAHOWOBDPK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |