C17H20N2O2 — CID 43275383
N-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methyl]cyclopropanamine (PubChem CID 43275383) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is N-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 43275383 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | N-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methyl]cyclopropanamine |
| SMILES | COc1cc(CNC2CC2)ccc1OCc1ccncc1 |
| InChI | InChI=1S/C17H20N2O2/c1-20-17-10-14(11-19-15-3-4-15)2-5-16(17)21-12-13-6-8-18-9-7-13/h2,5-10,15,19H,3-4,11-12H2,1H3 |
| InChIKey | KAFZWKQNEKXHLZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |