C19H23ClN2O2S — CID 11222686
1-[2-(3-chlorophenyl)ethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]thiourea (PubChem CID 11222686) has the molecular formula C19H23ClN2O2S and a molecular weight of 378.93 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]thiourea.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 11222686 |
| Molecular Formula | C19H23ClN2O2S |
| Molecular Weight | 378.93 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]thiourea |
| SMILES | COc1ccc(CCNC(=S)NCCc2cccc(Cl)c2)cc1OC |
| InChI | InChI=1S/C19H23ClN2O2S/c1-23-17-7-6-15(13-18(17)24-2)9-11-22-19(25)21-10-8-14-4-3-5-16(20)12-14/h3-7,12-13H,8-11H2,1-2H3,(H2,21,22,25) |
| InChIKey | RIFAEBBYMHSLHS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.93 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|