C19H23ClN2O3 — CID 109033247
N-[2-(3-chlorophenyl)ethyl]-3-(3,4-dimethoxyanilino)propanamide (PubChem CID 109033247) has the molecular formula C19H23ClN2O3 and a molecular weight of 362.86 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-3-(3,4-dimethoxyanilino)propanamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-3-(3,4-dimethoxyanilino)propanamide |
|---|---|
| PubChem CID | 109033247 |
| Molecular Formula | C19H23ClN2O3 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-3-(3,4-dimethoxyanilino)propanamide |
| SMILES | COc1ccc(NCCC(=O)NCCc2cccc(Cl)c2)cc1OC |
| InChI | InChI=1S/C19H23ClN2O3/c1-24-17-7-6-16(13-18(17)25-2)21-11-9-19(23)22-10-8-14-4-3-5-15(20)12-14/h3-7,12-13,21H,8-11H2,1-2H3,(H,22,23) |
| InChIKey | RQNXCQPVZOZEDB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|