C21H26N2O4 — CID 109027780
3-(3-acetylanilino)-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide (PubChem CID 109027780) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 3-(3-acetylanilino)-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide.
| Compound Name | 3-(3-acetylanilino)-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 109027780 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 3-(3-acetylanilino)-N-[2-(3,4-dimethoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccc(CCNC(=O)CCNc2cccc(C(C)=O)c2)cc1OC |
| InChI | InChI=1S/C21H26N2O4/c1-15(24)17-5-4-6-18(14-17)22-12-10-21(25)23-11-9-16-7-8-19(26-2)20(13-16)27-3/h4-8,13-14,22H,9-12H2,1-3H3,(H,23,25) |
| InChIKey | PEGJMZAKBLJWDH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |