C19H21F3N2O3 — CID 109027802
N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2,3,4-trifluoroanilino)propanamide (PubChem CID 109027802) has the molecular formula C19H21F3N2O3 and a molecular weight of 382.38 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2,3,4-trifluoroanilino)propanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2,3,4-trifluoroanilino)propanamide |
|---|---|
| PubChem CID | 109027802 |
| Molecular Formula | C19H21F3N2O3 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2,3,4-trifluoroanilino)propanamide |
| SMILES | COc1ccc(CCNC(=O)CCNc2ccc(F)c(F)c2F)cc1OC |
| InChI | InChI=1S/C19H21F3N2O3/c1-26-15-6-3-12(11-16(15)27-2)7-9-24-17(25)8-10-23-14-5-4-13(20)18(21)19(14)22/h3-6,11,23H,7-10H2,1-2H3,(H,24,25) |
| InChIKey | NBRCPUIGLQILDH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|