C19H22F2N2O3 — CID 109027869
N-(2,4-difluorophenyl)-3-[2-(3,4-dimethoxyphenyl)ethylamino]propanamide (PubChem CID 109027869) has the molecular formula C19H22F2N2O3 and a molecular weight of 364.39 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-3-[2-(3,4-dimethoxyphenyl)ethylamino]propanamide.
| Compound Name | N-(2,4-difluorophenyl)-3-[2-(3,4-dimethoxyphenyl)ethylamino]propanamide |
|---|---|
| PubChem CID | 109027869 |
| Molecular Formula | C19H22F2N2O3 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-(2,4-difluorophenyl)-3-[2-(3,4-dimethoxyphenyl)ethylamino]propanamide |
| SMILES | COc1ccc(CCNCCC(=O)Nc2ccc(F)cc2F)cc1OC |
| InChI | InChI=1S/C19H22F2N2O3/c1-25-17-6-3-13(11-18(17)26-2)7-9-22-10-8-19(24)23-16-5-4-14(20)12-15(16)21/h3-6,11-12,22H,7-10H2,1-2H3,(H,23,24) |
| InChIKey | NGGASHFBMCRBRX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|