C18H19F2NO3 — CID 110426742
N-(2,4-difluorophenyl)-4-(3,4-dimethoxyphenyl)butanamide (PubChem CID 110426742) has the molecular formula C18H19F2NO3 and a molecular weight of 335.35 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-(3,4-dimethoxyphenyl)butanamide.
| Compound Name | N-(2,4-difluorophenyl)-4-(3,4-dimethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 110426742 |
| Molecular Formula | C18H19F2NO3 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-(3,4-dimethoxyphenyl)butanamide |
| SMILES | COc1ccc(CCCC(=O)Nc2ccc(F)cc2F)cc1OC |
| InChI | InChI=1S/C18H19F2NO3/c1-23-16-9-6-12(10-17(16)24-2)4-3-5-18(22)21-15-8-7-13(19)11-14(15)20/h6-11H,3-5H2,1-2H3,(H,21,22) |
| InChIKey | PQAWRGVZKNIEGR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |