C16H17F2NO4S — CID 110673847
N-(2,4-difluorophenyl)-2-(3,4-dimethoxyphenyl)ethanesulfonamide (PubChem CID 110673847) has the molecular formula C16H17F2NO4S and a molecular weight of 357.38 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-(3,4-dimethoxyphenyl)ethanesulfonamide.
| Compound Name | N-(2,4-difluorophenyl)-2-(3,4-dimethoxyphenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 110673847 |
| Molecular Formula | C16H17F2NO4S |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-(3,4-dimethoxyphenyl)ethanesulfonamide |
| SMILES | COc1ccc(CCS(=O)(=O)Nc2ccc(F)cc2F)cc1OC |
| InChI | InChI=1S/C16H17F2NO4S/c1-22-15-6-3-11(9-16(15)23-2)7-8-24(20,21)19-14-5-4-12(17)10-13(14)18/h3-6,9-10,19H,7-8H2,1-2H3 |
| InChIKey | LKBPBSXXSVSOHJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |