C14H13F2NO3S — CID 900628
N-(2,4-difluorophenyl)-4-methoxy-3-methylbenzenesulfonamide (PubChem CID 900628) has the molecular formula C14H13F2NO3S and a molecular weight of 313.33 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-methoxy-3-methylbenzenesulfonamide.
| Compound Name | N-(2,4-difluorophenyl)-4-methoxy-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 900628 |
| Molecular Formula | C14H13F2NO3S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-methoxy-3-methylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(F)cc2F)cc1C |
| InChI | InChI=1S/C14H13F2NO3S/c1-9-7-11(4-6-14(9)20-2)21(18,19)17-13-5-3-10(15)8-12(13)16/h3-8,17H,1-2H3 |
| InChIKey | RFEWYPIVTPISEC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |