C21H20F2N2O5S2 — CID 138393240
1-N,3-N-bis(4-fluoro-2-methylphenyl)-4-methoxybenzene-1,3-disulfonamide (PubChem CID 138393240) has the molecular formula C21H20F2N2O5S2 and a molecular weight of 482.53 g/mol. Its IUPAC name is 1-N,3-N-bis(4-fluoro-2-methylphenyl)-4-methoxybenzene-1,3-disulfonamide.
| Compound Name | 1-N,3-N-bis(4-fluoro-2-methylphenyl)-4-methoxybenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 138393240 |
| Molecular Formula | C21H20F2N2O5S2 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 1-N,3-N-bis(4-fluoro-2-methylphenyl)-4-methoxybenzene-1,3-disulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(F)cc2C)cc1S(=O)(=O)Nc1ccc(F)cc1C |
| InChI | InChI=1S/C21H20F2N2O5S2/c1-13-10-15(22)4-7-18(13)24-31(26,27)17-6-9-20(30-3)21(12-17)32(28,29)25-19-8-5-16(23)11-14(19)2/h4-12,24-25H,1-3H3 |
| InChIKey | HVAGFOIYWQMYMN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |