C23H25FN2O5S — CID 98296364
5-[[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-(4-fluoro-2-methylphenyl)-2-methoxybenzenesulfonamide (PubChem CID 98296364) has the molecular formula C23H25FN2O5S and a molecular weight of 460.53 g/mol. Its IUPAC name is 5-[[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-(4-fluoro-2-methylphenyl)-2-methoxybenzenesulfonamide.
| Compound Name | 5-[[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-(4-fluoro-2-methylphenyl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 98296364 |
| Molecular Formula | C23H25FN2O5S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 5-[[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-(4-fluoro-2-methylphenyl)-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(CN2C(=O)[C@H]3CCCC[C@H]3C2=O)cc1S(=O)(=O)Nc1ccc(F)cc1C |
| InChI | InChI=1S/C23H25FN2O5S/c1-14-11-16(24)8-9-19(14)25-32(29,30)21-12-15(7-10-20(21)31-2)13-26-22(27)17-5-3-4-6-18(17)23(26)28/h7-12,17-18,25H,3-6,13H2,1-2H3/t17-,18+ |
| InChIKey | FJVAYQHKHLBJFP-HDICACEKSA-N |
| XLogP | 3.62 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|