C24H28N2O5S — CID 98296383
5-[[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-2-methoxy-N-[(2-methylphenyl)methyl]benzenesulfonamide (PubChem CID 98296383) has the molecular formula C24H28N2O5S and a molecular weight of 456.56 g/mol. Its IUPAC name is 5-[[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-2-methoxy-N-[(2-methylphenyl)methyl]benzenesulfonamide.
| Compound Name | 5-[[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-2-methoxy-N-[(2-methylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 98296383 |
| Molecular Formula | C24H28N2O5S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 5-[[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-2-methoxy-N-[(2-methylphenyl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(CN2C(=O)[C@H]3CCCC[C@H]3C2=O)cc1S(=O)(=O)NCc1ccccc1C |
| InChI | InChI=1S/C24H28N2O5S/c1-16-7-3-4-8-18(16)14-25-32(29,30)22-13-17(11-12-21(22)31-2)15-26-23(27)19-9-5-6-10-20(19)24(26)28/h3-4,7-8,11-13,19-20,25H,5-6,9-10,14-15H2,1-2H3/t19-,20+ |
| InChIKey | MTMFTGRAEWNSDL-BGYRXZFFSA-N |
| XLogP | 3.16 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|