C26H30N2O5S — CID 46296349
5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)methyl]-2-methoxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzenesulfonamide (PubChem CID 46296349) has the molecular formula C26H30N2O5S and a molecular weight of 482.60 g/mol. Its IUPAC name is 5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)methyl]-2-methoxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzenesulfonamide.
| Compound Name | 5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)methyl]-2-methoxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 46296349 |
| Molecular Formula | C26H30N2O5S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)methyl]-2-methoxy-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzenesulfonamide |
| SMILES | COc1ccc(CN2C(=O)C3CCCCC3C2=O)cc1S(=O)(=O)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C26H30N2O5S/c1-33-23-14-13-17(16-28-25(29)20-10-4-5-11-21(20)26(28)30)15-24(23)34(31,32)27-22-12-6-8-18-7-2-3-9-19(18)22/h2-3,7,9,13-15,20-22,27H,4-6,8,10-12,16H2,1H3 |
| InChIKey | MGVQICLROYASIF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|