C24H34N2O5S — CID 46296321
N-cyclooctyl-5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)methyl]-2-methoxybenzenesulfonamide (PubChem CID 46296321) has the molecular formula C24H34N2O5S and a molecular weight of 462.61 g/mol. Its IUPAC name is N-cyclooctyl-5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)methyl]-2-methoxybenzenesulfonamide.
| Compound Name | N-cyclooctyl-5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)methyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 46296321 |
| Molecular Formula | C24H34N2O5S |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | N-cyclooctyl-5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)methyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(CN2C(=O)C3CCCCC3C2=O)cc1S(=O)(=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C24H34N2O5S/c1-31-21-14-13-17(16-26-23(27)19-11-7-8-12-20(19)24(26)28)15-22(21)32(29,30)25-18-9-5-3-2-4-6-10-18/h13-15,18-20,25H,2-12,16H2,1H3 |
| InChIKey | OSZDENGGOOHVJX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|