C21H28N2O4S — CID 98226805
5-[[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-cyclopentyl-2-methylbenzenesulfonamide (PubChem CID 98226805) has the molecular formula C21H28N2O4S and a molecular weight of 404.53 g/mol. Its IUPAC name is 5-[[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-cyclopentyl-2-methylbenzenesulfonamide.
| Compound Name | 5-[[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-cyclopentyl-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 98226805 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 5-[[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-cyclopentyl-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(CN2C(=O)[C@H]3CCCC[C@@H]3C2=O)cc1S(=O)(=O)NC1CCCC1 |
| InChI | InChI=1S/C21H28N2O4S/c1-14-10-11-15(12-19(14)28(26,27)22-16-6-2-3-7-16)13-23-20(24)17-8-4-5-9-18(17)21(23)25/h10-12,16-18,22H,2-9,13H2,1H3/t17-,18-/m0/s1 |
| InChIKey | CSYRKCRRUKMASE-ROUUACIJSA-N |
| XLogP | 2.89 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|