C19H26N2O4S — CID 50769217
5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)methyl]-2-methyl-N-propylbenzenesulfonamide (PubChem CID 50769217) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is 5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)methyl]-2-methyl-N-propylbenzenesulfonamide.
| Compound Name | 5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)methyl]-2-methyl-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 50769217 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)methyl]-2-methyl-N-propylbenzenesulfonamide |
| SMILES | CCCNS(=O)(=O)c1cc(CN2C(=O)C3CCCCC3C2=O)ccc1C |
| InChI | InChI=1S/C19H26N2O4S/c1-3-10-20-26(24,25)17-11-14(9-8-13(17)2)12-21-18(22)15-6-4-5-7-16(15)19(21)23/h8-9,11,15-16,20H,3-7,10,12H2,1-2H3 |
| InChIKey | LDJVIEXXTYRRTC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|