C20H23N3O5S — CID 92888470
5-[[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-2-methyl-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide (PubChem CID 92888470) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is 5-[[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-2-methyl-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide.
| Compound Name | 5-[[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-2-methyl-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 92888470 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 5-[[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-2-methyl-N-(5-methyl-1,2-oxazol-3-yl)benzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cc(CN3C(=O)[C@H]4CCCC[C@@H]4C3=O)ccc2C)no1 |
| InChI | InChI=1S/C20H23N3O5S/c1-12-7-8-14(10-17(12)29(26,27)22-18-9-13(2)28-21-18)11-23-19(24)15-5-3-4-6-16(15)20(23)25/h7-10,15-16H,3-6,11H2,1-2H3,(H,21,22)/t15-,16-/m0/s1 |
| InChIKey | DQIDRXCIXVVXDL-HOTGVXAUSA-N |
| XLogP | 2.77 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|