C24H28N2O6S — CID 46296225
N-(2,4-dimethoxyphenyl)-5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)methyl]-2-methylbenzenesulfonamide (PubChem CID 46296225) has the molecular formula C24H28N2O6S and a molecular weight of 472.56 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)methyl]-2-methylbenzenesulfonamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)methyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 46296225 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-5-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)methyl]-2-methylbenzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(CN3C(=O)C4CCCCC4C3=O)ccc2C)c(OC)c1 |
| InChI | InChI=1S/C24H28N2O6S/c1-15-8-9-16(14-26-23(27)18-6-4-5-7-19(18)24(26)28)12-22(15)33(29,30)25-20-11-10-17(31-2)13-21(20)32-3/h8-13,18-19,25H,4-7,14H2,1-3H3 |
| InChIKey | VWDNUCARKDYLLP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|