C22H23ClN2O4S — CID 92867176
5-[[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-(2-chlorophenyl)-2-methylbenzenesulfonamide (PubChem CID 92867176) has the molecular formula C22H23ClN2O4S and a molecular weight of 446.96 g/mol. Its IUPAC name is 5-[[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-(2-chlorophenyl)-2-methylbenzenesulfonamide.
| Compound Name | 5-[[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-(2-chlorophenyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 92867176 |
| Molecular Formula | C22H23ClN2O4S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 5-[[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl]-N-(2-chlorophenyl)-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(CN2C(=O)[C@@H]3CCCC[C@H]3C2=O)cc1S(=O)(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C22H23ClN2O4S/c1-14-10-11-15(13-25-21(26)16-6-2-3-7-17(16)22(25)27)12-20(14)30(28,29)24-19-9-5-4-8-18(19)23/h4-5,8-12,16-17,24H,2-3,6-7,13H2,1H3/t16-,17-/m1/s1 |
| InChIKey | JLARNNGSFSIAQE-IAGOWNOFSA-N |
| XLogP | 4.12 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|