C19H14F2I2N2O5S2 — CID 141157193
1-N,3-N-bis(5-fluoro-2-iodophenyl)-4-methoxybenzene-1,3-disulfonamide (PubChem CID 141157193) has the molecular formula C19H14F2I2N2O5S2 and a molecular weight of 706.27 g/mol. Its IUPAC name is 1-N,3-N-bis(5-fluoro-2-iodophenyl)-4-methoxybenzene-1,3-disulfonamide.
| Compound Name | 1-N,3-N-bis(5-fluoro-2-iodophenyl)-4-methoxybenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 141157193 |
| Molecular Formula | C19H14F2I2N2O5S2 |
| Molecular Weight | 706.27 g/mol |
| Exact Mass | 705.84 |
| IUPAC Name | 1-N,3-N-bis(5-fluoro-2-iodophenyl)-4-methoxybenzene-1,3-disulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cc(F)ccc2I)cc1S(=O)(=O)Nc1cc(F)ccc1I |
| InChI | InChI=1S/C19H14F2I2N2O5S2/c1-30-18-7-4-13(31(26,27)24-16-8-11(20)2-5-14(16)22)10-19(18)32(28,29)25-17-9-12(21)3-6-15(17)23/h2-10,24-25H,1H3 |
| InChIKey | DIZXOMICGGSXGT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.27 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|