C19H14F2N4O7S2 — CID 141157297
1-N,3-N-bis(2-fluoro-3-nitrosophenyl)-4-methoxybenzene-1,3-disulfonamide (PubChem CID 141157297) has the molecular formula C19H14F2N4O7S2 and a molecular weight of 512.47 g/mol. Its IUPAC name is 1-N,3-N-bis(2-fluoro-3-nitrosophenyl)-4-methoxybenzene-1,3-disulfonamide.
| Compound Name | 1-N,3-N-bis(2-fluoro-3-nitrosophenyl)-4-methoxybenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 141157297 |
| Molecular Formula | C19H14F2N4O7S2 |
| Molecular Weight | 512.47 g/mol |
| Exact Mass | 512.03 |
| IUPAC Name | 1-N,3-N-bis(2-fluoro-3-nitrosophenyl)-4-methoxybenzene-1,3-disulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cccc(N=O)c2F)cc1S(=O)(=O)Nc1cccc(N=O)c1F |
| InChI | InChI=1S/C19H14F2N4O7S2/c1-32-16-9-8-11(33(28,29)24-14-6-2-4-12(22-26)18(14)20)10-17(16)34(30,31)25-15-7-3-5-13(23-27)19(15)21/h2-10,24-25H,1H3 |
| InChIKey | RVEIVLJKMWZWGE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 160.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |