C14H12F3NO5S2 — CID 110300294
2-methoxy-5-methylsulfonyl-N-(2,3,4-trifluorophenyl)benzenesulfonamide (PubChem CID 110300294) has the molecular formula C14H12F3NO5S2 and a molecular weight of 395.38 g/mol. Its IUPAC name is 2-methoxy-5-methylsulfonyl-N-(2,3,4-trifluorophenyl)benzenesulfonamide.
| Compound Name | 2-methoxy-5-methylsulfonyl-N-(2,3,4-trifluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110300294 |
| Molecular Formula | C14H12F3NO5S2 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | 2-methoxy-5-methylsulfonyl-N-(2,3,4-trifluorophenyl)benzenesulfonamide |
| SMILES | COc1ccc(S(C)(=O)=O)cc1S(=O)(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H12F3NO5S2/c1-23-11-6-3-8(24(2,19)20)7-12(11)25(21,22)18-10-5-4-9(15)13(16)14(10)17/h3-7,18H,1-2H3 |
| InChIKey | MGYBWRTUMDIVTM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|