C17H21NO5S2 — CID 110300252
2-methoxy-5-methylsulfonyl-N-(4-propan-2-ylphenyl)benzenesulfonamide (PubChem CID 110300252) has the molecular formula C17H21NO5S2 and a molecular weight of 383.49 g/mol. Its IUPAC name is 2-methoxy-5-methylsulfonyl-N-(4-propan-2-ylphenyl)benzenesulfonamide.
| Compound Name | 2-methoxy-5-methylsulfonyl-N-(4-propan-2-ylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110300252 |
| Molecular Formula | C17H21NO5S2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 2-methoxy-5-methylsulfonyl-N-(4-propan-2-ylphenyl)benzenesulfonamide |
| SMILES | COc1ccc(S(C)(=O)=O)cc1S(=O)(=O)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C17H21NO5S2/c1-12(2)13-5-7-14(8-6-13)18-25(21,22)17-11-15(24(4,19)20)9-10-16(17)23-3/h5-12,18H,1-4H3 |
| InChIKey | XNQFTDKZWGRISY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |