C16H20N2O5S2 — CID 110300283
N-[4-(dimethylamino)phenyl]-2-methoxy-5-methylsulfonylbenzenesulfonamide (PubChem CID 110300283) has the molecular formula C16H20N2O5S2 and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-methoxy-5-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-methoxy-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 110300283 |
| Molecular Formula | C16H20N2O5S2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-methoxy-5-methylsulfonylbenzenesulfonamide |
| SMILES | COc1ccc(S(C)(=O)=O)cc1S(=O)(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C16H20N2O5S2/c1-18(2)13-7-5-12(6-8-13)17-25(21,22)16-11-14(24(4,19)20)9-10-15(16)23-3/h5-11,17H,1-4H3 |
| InChIKey | JXGWQQGNLANASJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|