C14H13Cl3N2O2S — CID 22774991
2,4,5-trichloro-N-[4-(dimethylamino)phenyl]benzenesulfonamide (PubChem CID 22774991) has the molecular formula C14H13Cl3N2O2S and a molecular weight of 379.70 g/mol. Its IUPAC name is 2,4,5-trichloro-N-[4-(dimethylamino)phenyl]benzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-[4-(dimethylamino)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22774991 |
| Molecular Formula | C14H13Cl3N2O2S |
| Molecular Weight | 379.70 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | 2,4,5-trichloro-N-[4-(dimethylamino)phenyl]benzenesulfonamide |
| SMILES | CN(C)c1ccc(NS(=O)(=O)c2cc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C14H13Cl3N2O2S/c1-19(2)10-5-3-9(4-6-10)18-22(20,21)14-8-12(16)11(15)7-13(14)17/h3-8,18H,1-2H3 |
| InChIKey | HCYRWSBMYBSGJT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.70 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|