C14H16N2O4S — CID 143109369
N-[4-(dimethylamino)phenyl]-2,3-dihydroxybenzenesulfonamide (PubChem CID 143109369) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2,3-dihydroxybenzenesulfonamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2,3-dihydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 143109369 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2,3-dihydroxybenzenesulfonamide |
| SMILES | CN(C)c1ccc(NS(=O)(=O)c2cccc(O)c2O)cc1 |
| InChI | InChI=1S/C14H16N2O4S/c1-16(2)11-8-6-10(7-9-11)15-21(19,20)13-5-3-4-12(17)14(13)18/h3-9,15,17-18H,1-2H3 |
| InChIKey | BXDHCJGXJVMSSG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|