C15H15F3N2O3S — CID 70331395
N-[4-(dimethylamino)phenyl]-2-hydroxy-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 70331395) has the molecular formula C15H15F3N2O3S and a molecular weight of 360.36 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-2-hydroxy-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-2-hydroxy-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 70331395 |
| Molecular Formula | C15H15F3N2O3S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-2-hydroxy-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | CN(C)c1ccc(NS(=O)(=O)c2cc(C(F)(F)F)ccc2O)cc1 |
| InChI | InChI=1S/C15H15F3N2O3S/c1-20(2)12-6-4-11(5-7-12)19-24(22,23)14-9-10(15(16,17)18)3-8-13(14)21/h3-9,19,21H,1-2H3 |
| InChIKey | DCGAHPBJJOJGRR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|