C12H14F3NO5S — CID 122069110
(2S)-2-[[2-hydroxy-5-(trifluoromethyl)phenyl]sulfonylamino]-3-methylbutanoic acid (PubChem CID 122069110) has the molecular formula C12H14F3NO5S and a molecular weight of 341.31 g/mol. Its IUPAC name is (2S)-2-[[2-hydroxy-5-(trifluoromethyl)phenyl]sulfonylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[2-hydroxy-5-(trifluoromethyl)phenyl]sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 122069110 |
| Molecular Formula | C12H14F3NO5S |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | (2S)-2-[[2-hydroxy-5-(trifluoromethyl)phenyl]sulfonylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1cc(C(F)(F)F)ccc1O)C(=O)O |
| InChI | InChI=1S/C12H14F3NO5S/c1-6(2)10(11(18)19)16-22(20,21)9-5-7(12(13,14)15)3-4-8(9)17/h3-6,10,16-17H,1-2H3,(H,18,19)/t10-/m0/s1 |
| InChIKey | NQFOGDLJSJOIDX-JTQLQIEISA-N |
| XLogP | 1.80 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |