C11H11ClF3NO4S — CID 43240869
3-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]butanoic acid (PubChem CID 43240869) has the molecular formula C11H11ClF3NO4S and a molecular weight of 345.73 g/mol. Its IUPAC name is 3-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]butanoic acid.
| Compound Name | 3-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 43240869 |
| Molecular Formula | C11H11ClF3NO4S |
| Molecular Weight | 345.73 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 3-[[2-chloro-5-(trifluoromethyl)phenyl]sulfonylamino]butanoic acid |
| SMILES | CC(CC(=O)O)NS(=O)(=O)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C11H11ClF3NO4S/c1-6(4-10(17)18)16-21(19,20)9-5-7(11(13,14)15)2-3-8(9)12/h2-3,5-6,16H,4H2,1H3,(H,17,18) |
| InChIKey | QHRTVFLCEPZUOY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.73 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |