C12H14ClF3N2O3S — CID 90007957
1-tert-butyl-3-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylurea (PubChem CID 90007957) has the molecular formula C12H14ClF3N2O3S and a molecular weight of 358.77 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylurea.
| Compound Name | 1-tert-butyl-3-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylurea |
|---|---|
| PubChem CID | 90007957 |
| Molecular Formula | C12H14ClF3N2O3S |
| Molecular Weight | 358.77 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 1-tert-butyl-3-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylurea |
| SMILES | CC(C)(C)NC(=O)NS(=O)(=O)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C12H14ClF3N2O3S/c1-11(2,3)17-10(19)18-22(20,21)9-6-7(12(14,15)16)4-5-8(9)13/h4-6H,1-3H3,(H2,17,18,19) |
| InChIKey | XEGRTXYFQKFSJA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.77 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |