C17H22ClF3N2O3S — CID 4848895
N-tert-butyl-1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 4848895) has the molecular formula C17H22ClF3N2O3S and a molecular weight of 426.89 g/mol. Its IUPAC name is N-tert-butyl-1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-tert-butyl-1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 4848895 |
| Molecular Formula | C17H22ClF3N2O3S |
| Molecular Weight | 426.89 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | N-tert-butyl-1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1CCN(S(=O)(=O)c2cc(C(F)(F)F)ccc2Cl)CC1 |
| InChI | InChI=1S/C17H22ClF3N2O3S/c1-16(2,3)22-15(24)11-6-8-23(9-7-11)27(25,26)14-10-12(17(19,20)21)4-5-13(14)18/h4-5,10-11H,6-9H2,1-3H3,(H,22,24) |
| InChIKey | ZGGUYRHEBVKERD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.89 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |