C16H20ClF3N2O2S — CID 119987431
1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-N-(cyclopropylmethyl)piperidin-4-amine (PubChem CID 119987431) has the molecular formula C16H20ClF3N2O2S and a molecular weight of 396.86 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-N-(cyclopropylmethyl)piperidin-4-amine.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-N-(cyclopropylmethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 119987431 |
| Molecular Formula | C16H20ClF3N2O2S |
| Molecular Weight | 396.86 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]sulfonyl-N-(cyclopropylmethyl)piperidin-4-amine |
| SMILES | O=S(=O)(c1cc(C(F)(F)F)ccc1Cl)N1CCC(NCC2CC2)CC1 |
| InChI | InChI=1S/C16H20ClF3N2O2S/c17-14-4-3-12(16(18,19)20)9-15(14)25(23,24)22-7-5-13(6-8-22)21-10-11-1-2-11/h3-4,9,11,13,21H,1-2,5-8,10H2 |
| InChIKey | MXUACUDQIORWSZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.86 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |