C15H19Cl2FN2O2S — CID 120711470
N-(cyclopropylmethyl)-1-(2,4-dichloro-3-fluorophenyl)sulfonylpiperidin-4-amine (PubChem CID 120711470) has the molecular formula C15H19Cl2FN2O2S and a molecular weight of 381.30 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1-(2,4-dichloro-3-fluorophenyl)sulfonylpiperidin-4-amine.
| Compound Name | N-(cyclopropylmethyl)-1-(2,4-dichloro-3-fluorophenyl)sulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 120711470 |
| Molecular Formula | C15H19Cl2FN2O2S |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | N-(cyclopropylmethyl)-1-(2,4-dichloro-3-fluorophenyl)sulfonylpiperidin-4-amine |
| SMILES | O=S(=O)(c1ccc(Cl)c(F)c1Cl)N1CCC(NCC2CC2)CC1 |
| InChI | InChI=1S/C15H19Cl2FN2O2S/c16-12-3-4-13(14(17)15(12)18)23(21,22)20-7-5-11(6-8-20)19-9-10-1-2-10/h3-4,10-11,19H,1-2,5-9H2 |
| InChIKey | OSSWZWZBFWEPLW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|