C11H13Cl2FN2O2S — CID 103088944
2,4-dichloro-N-[2-(cyclopropylamino)ethyl]-3-fluorobenzenesulfonamide (PubChem CID 103088944) has the molecular formula C11H13Cl2FN2O2S and a molecular weight of 327.21 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-(cyclopropylamino)ethyl]-3-fluorobenzenesulfonamide.
| Compound Name | 2,4-dichloro-N-[2-(cyclopropylamino)ethyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 103088944 |
| Molecular Formula | C11H13Cl2FN2O2S |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 2,4-dichloro-N-[2-(cyclopropylamino)ethyl]-3-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCNC1CC1)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C11H13Cl2FN2O2S/c12-8-3-4-9(10(13)11(8)14)19(17,18)16-6-5-15-7-1-2-7/h3-4,7,15-16H,1-2,5-6H2 |
| InChIKey | NKWWKSYRIFLESX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|